C48H62N4O4 — CID 66955195
[(1S,2S,4S)-4-(dibenzylamino)-4-[[(1R,2R,4R)-4-(dibenzylamino)-2-methylcyclohexyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-methylcyclohexyl]carbamic acid (PubChem CID 66955195) has the molecular formula C48H62N4O4 and a molecular weight of 759.05 g/mol. Its IUPAC name is [(1S,2S,4S)-4-(dibenzylamino)-4-[[(1R,2R,4R)-4-(dibenzylamino)-2-methylcyclohexyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-methylcyclohexyl]carbamic acid.
| Compound Name | [(1S,2S,4S)-4-(dibenzylamino)-4-[[(1R,2R,4R)-4-(dibenzylamino)-2-methylcyclohexyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-methylcyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 66955195 |
| Molecular Formula | C48H62N4O4 |
| Molecular Weight | 759.05 g/mol |
| Exact Mass | 758.48 |
| IUPAC Name | [(1S,2S,4S)-4-(dibenzylamino)-4-[[(1R,2R,4R)-4-(dibenzylamino)-2-methylcyclohexyl]-[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-methylcyclohexyl]carbamic acid |
| SMILES | C[C@@H]1C[C@H](N(Cc2ccccc2)Cc2ccccc2)CC[C@H]1N(C(=O)OC(C)(C)C)[C@@]1(N(Cc2ccccc2)Cc2ccccc2)CC[C@H](NC(=O)O)[C@@H](C)C1 |
| InChI | InChI=1S/C48H62N4O4/c1-36-30-42(50(32-38-18-10-6-11-19-38)33-39-20-12-7-13-21-39)26-27-44(36)52(46(55)56-47(3,4)5)48(29-28-43(37(2)31-48)49-45(53)54)51(34-40-22-14-8-15-23-40)35-41-24-16-9-17-25-41/h6-25,36-37,42-44,49H,26-35H2,1-5H3,(H,53,54)/t36-,37+,42-,43+,44-,48+/m1/s1 |
| InChIKey | MKJCSWZPHPCHBD-LDXDQOKESA-N |
| XLogP | 10.34 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.05 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|