About 5-bromo-6-(bromomethyl)-2,5-dimethoxycyclohexa-1,3-diene
5-bromo-6-(bromomethyl)-2,5-dimethoxycyclohexa-1,3-diene (PubChem CID 66956427) has the molecular formula C9H12Br2O2
and a molecular weight of 312.00 g/mol. Its IUPAC name is 5-bromo-6-(bromomethyl)-2,5-dimethoxycyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 5-bromo-6-(bromomethyl)-2,5-dimethoxycyclohexa-1,3-diene |
| PubChem CID | 66956427 |
| Molecular Formula | C9H12Br2O2 |
| Molecular Weight | 312.00 g/mol |
| Exact Mass | 309.92 |
| IUPAC Name | 5-bromo-6-(bromomethyl)-2,5-dimethoxycyclohexa-1,3-diene |
| SMILES | COC1=CC(CBr)C(Br)(OC)C=C1 |
| InChI | InChI=1S/C9H12Br2O2/c1-12-8-3-4-9(11,13-2)7(5-8)6-10/h3-5,7H,6H2,1-2H3 |
| InChIKey | PCOGPPZFLHEDMX-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.00 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-6-(bromomethyl)-2,5-dimethoxycyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-6-(bromomethyl)-2,5-dimethoxycyclohexa-1,3-diene?
The IUPAC name of 5-bromo-6-(bromomethyl)-2,5-dimethoxycyclohexa-1,3-diene (CID 66956427) is 5-bromo-6-(bromomethyl)-2,5-dimethoxycyclohexa-1,3-diene.
What is the SMILES notation for 5-bromo-6-(bromomethyl)-2,5-dimethoxycyclohexa-1,3-diene?
The canonical SMILES for 5-bromo-6-(bromomethyl)-2,5-dimethoxycyclohexa-1,3-diene is COC1=CC(CBr)C(Br)(OC)C=C1.
What is the InChIKey of 5-bromo-6-(bromomethyl)-2,5-dimethoxycyclohexa-1,3-diene?
The InChIKey is PCOGPPZFLHEDMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12Br2O2/c1-12-8-3-4-9(11,13-2)7(5-8)6-10/h3-5,7H,6H2,1-2H3.
What are the key properties of 5-bromo-6-(bromomethyl)-2,5-dimethoxycyclohexa-1,3-diene?
5-bromo-6-(bromomethyl)-2,5-dimethoxycyclohexa-1,3-diene has a molecular weight of 312.00 g/mol, XLogP of 2.84, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-6-(bromomethyl)-2,5-dimethoxycyclohexa-1,3-diene is sourced from PubChem (CID 66956427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).