About bis(4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoic acid);hydrochloride
bis(4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoic acid);hydrochloride (PubChem CID 66957731) has the molecular formula C30H31ClN14O4
and a molecular weight of 687.12 g/mol. Its IUPAC name is bis(4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoic acid);hydrochloride.
Molecular Properties
| Compound Name | bis(4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoic acid);hydrochloride |
| PubChem CID | 66957731 |
| Molecular Formula | C30H31ClN14O4 |
| Molecular Weight | 687.12 g/mol |
| Exact Mass | 686.23 |
| IUPAC Name | bis(4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoic acid);hydrochloride |
| SMILES | CN(Cc1cnc2nc(N)nc(N)c2n1)c1ccc(C(=O)O)cc1.CN(Cc1cnc2nc(N)nc(N)c2n1)c1ccc(C(=O)O)cc1.Cl |
| InChI | InChI=1S/2C15H15N7O2.ClH/c2*1-22(10-4-2-8(3-5-10)14(23)24)7-9-6-18-13-11(19-9)12(16)20-15(17)21-13;/h2*2-6H,7H2,1H3,(H,23,24)(H4,16,17,18,20,21);1H |
| InChIKey | WWFYKUISNIJHNQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 288.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 687.12 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
Analyze bis(4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoic acid);hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoic acid);hydrochloride?
The IUPAC name of bis(4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoic acid);hydrochloride (CID 66957731) is bis(4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoic acid);hydrochloride.
What is the SMILES notation for bis(4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoic acid);hydrochloride?
The canonical SMILES for bis(4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoic acid);hydrochloride is CN(Cc1cnc2nc(N)nc(N)c2n1)c1ccc(C(=O)O)cc1.CN(Cc1cnc2nc(N)nc(N)c2n1)c1ccc(C(=O)O)cc1.Cl.
What is the InChIKey of bis(4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoic acid);hydrochloride?
The InChIKey is WWFYKUISNIJHNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C15H15N7O2.ClH/c2*1-22(10-4-2-8(3-5-10)14(23)24)7-9-6-18-13-11(19-9)12(16)20-15(17)21-13;/h2*2-6H,7H2,1H3,(H,23,24)(H4,16,17,18,20,21);1H.
What are the key properties of bis(4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoic acid);hydrochloride?
bis(4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoic acid);hydrochloride has a molecular weight of 687.12 g/mol, XLogP of 2.26, 8 rotatable bonds, 6 hydrogen bond donors, and 16 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-[(2,4-diaminopteridin-6-yl)methyl-methylamino]benzoic acid);hydrochloride is sourced from PubChem (CID 66957731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).