About methyl 3-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)thiophene-2-carboxylate
methyl 3-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)thiophene-2-carboxylate (PubChem CID 66957846) has the molecular formula C12H10N4O2S
and a molecular weight of 274.31 g/mol. Its IUPAC name is methyl 3-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)thiophene-2-carboxylate.
Molecular Properties
| Compound Name | methyl 3-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)thiophene-2-carboxylate |
| PubChem CID | 66957846 |
| Molecular Formula | C12H10N4O2S |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | methyl 3-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1Nc1ncnc2[nH]ccc12 |
| InChI | InChI=1S/C12H10N4O2S/c1-18-12(17)9-8(3-5-19-9)16-11-7-2-4-13-10(7)14-6-15-11/h2-6H,1H3,(H2,13,14,15,16) |
| InChIKey | XXYFMFICBSUYLO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 3-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)thiophene-2-carboxylate?
The IUPAC name of methyl 3-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)thiophene-2-carboxylate (CID 66957846) is methyl 3-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)thiophene-2-carboxylate.
What is the SMILES notation for methyl 3-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)thiophene-2-carboxylate?
The canonical SMILES for methyl 3-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)thiophene-2-carboxylate is COC(=O)c1sccc1Nc1ncnc2[nH]ccc12.
What is the InChIKey of methyl 3-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)thiophene-2-carboxylate?
The InChIKey is XXYFMFICBSUYLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N4O2S/c1-18-12(17)9-8(3-5-19-9)16-11-7-2-4-13-10(7)14-6-15-11/h2-6H,1H3,(H2,13,14,15,16).
What are the key properties of methyl 3-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)thiophene-2-carboxylate?
methyl 3-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)thiophene-2-carboxylate has a molecular weight of 274.31 g/mol, XLogP of 2.55, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)thiophene-2-carboxylate is sourced from PubChem (CID 66957846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).