C14H16ClN5O2S — CID 66958603
N-[3-[2-(chloromethyl)imidazo[4,5-c][1,5]naphthyridin-1-yl]propyl]methanesulfonamide (PubChem CID 66958603) has the molecular formula C14H16ClN5O2S and a molecular weight of 353.84 g/mol. Its IUPAC name is N-[3-[2-(chloromethyl)imidazo[4,5-c][1,5]naphthyridin-1-yl]propyl]methanesulfonamide.
| Compound Name | N-[3-[2-(chloromethyl)imidazo[4,5-c][1,5]naphthyridin-1-yl]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 66958603 |
| Molecular Formula | C14H16ClN5O2S |
| Molecular Weight | 353.84 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | N-[3-[2-(chloromethyl)imidazo[4,5-c][1,5]naphthyridin-1-yl]propyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCCn1c(CCl)nc2cnc3cccnc3c21 |
| InChI | InChI=1S/C14H16ClN5O2S/c1-23(21,22)18-6-3-7-20-12(8-15)19-11-9-17-10-4-2-5-16-13(10)14(11)20/h2,4-5,9,18H,3,6-8H2,1H3 |
| InChIKey | RXMCJGBYJDWNSD-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.84 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|