About 1-(2H-pyrazolo[3,4-c]quinolin-1-yl)prop-2-en-1-amine
1-(2H-pyrazolo[3,4-c]quinolin-1-yl)prop-2-en-1-amine (PubChem CID 66958743) has the molecular formula C13H12N4
and a molecular weight of 224.27 g/mol. Its IUPAC name is 1-(2H-pyrazolo[3,4-c]quinolin-1-yl)prop-2-en-1-amine.
Molecular Properties
| Compound Name | 1-(2H-pyrazolo[3,4-c]quinolin-1-yl)prop-2-en-1-amine |
| PubChem CID | 66958743 |
| Molecular Formula | C13H12N4 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 1-(2H-pyrazolo[3,4-c]quinolin-1-yl)prop-2-en-1-amine |
| SMILES | C=CC(N)c1[nH]nc2cnc3ccccc3c12 |
| InChI | InChI=1S/C13H12N4/c1-2-9(14)13-12-8-5-3-4-6-10(8)15-7-11(12)16-17-13/h2-7,9H,1,14H2,(H,16,17) |
| InChIKey | IPMDPXYRXOCKBK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(2H-pyrazolo[3,4-c]quinolin-1-yl)prop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2H-pyrazolo[3,4-c]quinolin-1-yl)prop-2-en-1-amine?
The IUPAC name of 1-(2H-pyrazolo[3,4-c]quinolin-1-yl)prop-2-en-1-amine (CID 66958743) is 1-(2H-pyrazolo[3,4-c]quinolin-1-yl)prop-2-en-1-amine.
What is the SMILES notation for 1-(2H-pyrazolo[3,4-c]quinolin-1-yl)prop-2-en-1-amine?
The canonical SMILES for 1-(2H-pyrazolo[3,4-c]quinolin-1-yl)prop-2-en-1-amine is C=CC(N)c1[nH]nc2cnc3ccccc3c12.
What is the InChIKey of 1-(2H-pyrazolo[3,4-c]quinolin-1-yl)prop-2-en-1-amine?
The InChIKey is IPMDPXYRXOCKBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N4/c1-2-9(14)13-12-8-5-3-4-6-10(8)15-7-11(12)16-17-13/h2-7,9H,1,14H2,(H,16,17).
What are the key properties of 1-(2H-pyrazolo[3,4-c]quinolin-1-yl)prop-2-en-1-amine?
1-(2H-pyrazolo[3,4-c]quinolin-1-yl)prop-2-en-1-amine has a molecular weight of 224.27 g/mol, XLogP of 2.30, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2H-pyrazolo[3,4-c]quinolin-1-yl)prop-2-en-1-amine is sourced from PubChem (CID 66958743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).