About 4,8-dibromobenzo[a]anthracene-7,12-dione
4,8-dibromobenzo[a]anthracene-7,12-dione (PubChem CID 66959056) has the molecular formula C18H8Br2O2
and a molecular weight of 416.07 g/mol. Its IUPAC name is 4,8-dibromobenzo[a]anthracene-7,12-dione.
Molecular Properties
| Compound Name | 4,8-dibromobenzo[a]anthracene-7,12-dione |
| PubChem CID | 66959056 |
| Molecular Formula | C18H8Br2O2 |
| Molecular Weight | 416.07 g/mol |
| Exact Mass | 413.89 |
| IUPAC Name | 4,8-dibromobenzo[a]anthracene-7,12-dione |
| SMILES | O=C1c2ccc3c(Br)cccc3c2C(=O)c2cccc(Br)c21 |
| InChI | InChI=1S/C18H8Br2O2/c19-13-5-1-3-10-9(13)7-8-12-15(10)17(21)11-4-2-6-14(20)16(11)18(12)22/h1-8H |
| InChIKey | JSXHSLMWEPZTFC-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.07 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 4,8-dibromobenzo[a]anthracene-7,12-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,8-dibromobenzo[a]anthracene-7,12-dione?
The IUPAC name of 4,8-dibromobenzo[a]anthracene-7,12-dione (CID 66959056) is 4,8-dibromobenzo[a]anthracene-7,12-dione.
What is the SMILES notation for 4,8-dibromobenzo[a]anthracene-7,12-dione?
The canonical SMILES for 4,8-dibromobenzo[a]anthracene-7,12-dione is O=C1c2ccc3c(Br)cccc3c2C(=O)c2cccc(Br)c21.
What is the InChIKey of 4,8-dibromobenzo[a]anthracene-7,12-dione?
The InChIKey is JSXHSLMWEPZTFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H8Br2O2/c19-13-5-1-3-10-9(13)7-8-12-15(10)17(21)11-4-2-6-14(20)16(11)18(12)22/h1-8H.
What are the key properties of 4,8-dibromobenzo[a]anthracene-7,12-dione?
4,8-dibromobenzo[a]anthracene-7,12-dione has a molecular weight of 416.07 g/mol, XLogP of 5.14, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,8-dibromobenzo[a]anthracene-7,12-dione is sourced from PubChem (CID 66959056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).