C25H37NO3SSi — CID 66959150
4-[2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]ethenyl]-N,N-diethylaniline (PubChem CID 66959150) has the molecular formula C25H37NO3SSi and a molecular weight of 459.73 g/mol. Its IUPAC name is 4-[2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]ethenyl]-N,N-diethylaniline.
| Compound Name | 4-[2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]ethenyl]-N,N-diethylaniline |
|---|---|
| PubChem CID | 66959150 |
| Molecular Formula | C25H37NO3SSi |
| Molecular Weight | 459.73 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | 4-[2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]ethenyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(C=Cc2scc3c2OCC(CO[Si](C)(C)C(C)(C)C)O3)cc1 |
| InChI | InChI=1S/C25H37NO3SSi/c1-8-26(9-2)20-13-10-19(11-14-20)12-15-23-24-22(18-30-23)29-21(16-27-24)17-28-31(6,7)25(3,4)5/h10-15,18,21H,8-9,16-17H2,1-7H3 |
| InChIKey | IENZDIWCZGINJZ-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.73 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|