C20H24N6O2 — CID 66959207
5-(cyclopropylamino)-7-[6-(3-methoxypropylamino)-3-pyridinyl]-3-methylpyrido[4,3-d]pyrimidin-4-one (PubChem CID 66959207) has the molecular formula C20H24N6O2 and a molecular weight of 380.45 g/mol. Its IUPAC name is 5-(cyclopropylamino)-7-[6-(3-methoxypropylamino)-3-pyridinyl]-3-methylpyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 5-(cyclopropylamino)-7-[6-(3-methoxypropylamino)-3-pyridinyl]-3-methylpyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 66959207 |
| Molecular Formula | C20H24N6O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 5-(cyclopropylamino)-7-[6-(3-methoxypropylamino)-3-pyridinyl]-3-methylpyrido[4,3-d]pyrimidin-4-one |
| SMILES | COCCCNc1ccc(-c2cc3ncn(C)c(=O)c3c(NC3CC3)n2)cn1 |
| InChI | InChI=1S/C20H24N6O2/c1-26-12-23-16-10-15(25-19(18(16)20(26)27)24-14-5-6-14)13-4-7-17(22-11-13)21-8-3-9-28-2/h4,7,10-12,14H,3,5-6,8-9H2,1-2H3,(H,21,22)(H,24,25) |
| InChIKey | NGKBRBYGJKSMQE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|