C19H21N5O4 — CID 66959336
N-[2-hydroxy-4-[5-(2-methoxyethylamino)-3-methyl-4-oxopyrido[4,3-d]pyrimidin-7-yl]phenyl]acetamide (PubChem CID 66959336) has the molecular formula C19H21N5O4 and a molecular weight of 383.41 g/mol. Its IUPAC name is N-[2-hydroxy-4-[5-(2-methoxyethylamino)-3-methyl-4-oxopyrido[4,3-d]pyrimidin-7-yl]phenyl]acetamide.
| Compound Name | N-[2-hydroxy-4-[5-(2-methoxyethylamino)-3-methyl-4-oxopyrido[4,3-d]pyrimidin-7-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 66959336 |
| Molecular Formula | C19H21N5O4 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | N-[2-hydroxy-4-[5-(2-methoxyethylamino)-3-methyl-4-oxopyrido[4,3-d]pyrimidin-7-yl]phenyl]acetamide |
| SMILES | COCCNc1nc(-c2ccc(NC(C)=O)c(O)c2)cc2ncn(C)c(=O)c12 |
| InChI | InChI=1S/C19H21N5O4/c1-11(25)22-13-5-4-12(8-16(13)26)14-9-15-17(19(27)24(2)10-21-15)18(23-14)20-6-7-28-3/h4-5,8-10,26H,6-7H2,1-3H3,(H,20,23)(H,22,25) |
| InChIKey | SCULLKBTRUKYKO-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 118.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|