About 7-(3,4-dimethoxyphenyl)-5-(2-methoxyethylamino)-3-methylpyrido[4,3-d]pyrimidin-4-one
7-(3,4-dimethoxyphenyl)-5-(2-methoxyethylamino)-3-methylpyrido[4,3-d]pyrimidin-4-one (PubChem CID 66959600) has the molecular formula C19H22N4O4
and a molecular weight of 370.41 g/mol. Its IUPAC name is 7-(3,4-dimethoxyphenyl)-5-(2-methoxyethylamino)-3-methylpyrido[4,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 7-(3,4-dimethoxyphenyl)-5-(2-methoxyethylamino)-3-methylpyrido[4,3-d]pyrimidin-4-one |
| PubChem CID | 66959600 |
| Molecular Formula | C19H22N4O4 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 7-(3,4-dimethoxyphenyl)-5-(2-methoxyethylamino)-3-methylpyrido[4,3-d]pyrimidin-4-one |
| SMILES | COCCNc1nc(-c2ccc(OC)c(OC)c2)cc2ncn(C)c(=O)c12 |
| InChI | InChI=1S/C19H22N4O4/c1-23-11-21-14-10-13(12-5-6-15(26-3)16(9-12)27-4)22-18(17(14)19(23)24)20-7-8-25-2/h5-6,9-11H,7-8H2,1-4H3,(H,20,22) |
| InChIKey | DUWJEIYPYAKQQB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-(3,4-dimethoxyphenyl)-5-(2-methoxyethylamino)-3-methylpyrido[4,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3,4-dimethoxyphenyl)-5-(2-methoxyethylamino)-3-methylpyrido[4,3-d]pyrimidin-4-one?
The IUPAC name of 7-(3,4-dimethoxyphenyl)-5-(2-methoxyethylamino)-3-methylpyrido[4,3-d]pyrimidin-4-one (CID 66959600) is 7-(3,4-dimethoxyphenyl)-5-(2-methoxyethylamino)-3-methylpyrido[4,3-d]pyrimidin-4-one.
What is the SMILES notation for 7-(3,4-dimethoxyphenyl)-5-(2-methoxyethylamino)-3-methylpyrido[4,3-d]pyrimidin-4-one?
The canonical SMILES for 7-(3,4-dimethoxyphenyl)-5-(2-methoxyethylamino)-3-methylpyrido[4,3-d]pyrimidin-4-one is COCCNc1nc(-c2ccc(OC)c(OC)c2)cc2ncn(C)c(=O)c12.
What is the InChIKey of 7-(3,4-dimethoxyphenyl)-5-(2-methoxyethylamino)-3-methylpyrido[4,3-d]pyrimidin-4-one?
The InChIKey is DUWJEIYPYAKQQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N4O4/c1-23-11-21-14-10-13(12-5-6-15(26-3)16(9-12)27-4)22-18(17(14)19(23)24)20-7-8-25-2/h5-6,9-11H,7-8H2,1-4H3,(H,20,22).
What are the key properties of 7-(3,4-dimethoxyphenyl)-5-(2-methoxyethylamino)-3-methylpyrido[4,3-d]pyrimidin-4-one?
7-(3,4-dimethoxyphenyl)-5-(2-methoxyethylamino)-3-methylpyrido[4,3-d]pyrimidin-4-one has a molecular weight of 370.41 g/mol, XLogP of 2.07, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3,4-dimethoxyphenyl)-5-(2-methoxyethylamino)-3-methylpyrido[4,3-d]pyrimidin-4-one is sourced from PubChem (CID 66959600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).