About 7-[1-(2-methoxyethyl)pyrazol-4-yl]-3-methyl-5-(propan-2-ylamino)pyrido[4,3-d]pyrimidin-4-one
7-[1-(2-methoxyethyl)pyrazol-4-yl]-3-methyl-5-(propan-2-ylamino)pyrido[4,3-d]pyrimidin-4-one (PubChem CID 66959610) has the molecular formula C17H22N6O2
and a molecular weight of 342.40 g/mol. Its IUPAC name is 7-[1-(2-methoxyethyl)pyrazol-4-yl]-3-methyl-5-(propan-2-ylamino)pyrido[4,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 7-[1-(2-methoxyethyl)pyrazol-4-yl]-3-methyl-5-(propan-2-ylamino)pyrido[4,3-d]pyrimidin-4-one |
| PubChem CID | 66959610 |
| Molecular Formula | C17H22N6O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 7-[1-(2-methoxyethyl)pyrazol-4-yl]-3-methyl-5-(propan-2-ylamino)pyrido[4,3-d]pyrimidin-4-one |
| SMILES | COCCn1cc(-c2cc3ncn(C)c(=O)c3c(NC(C)C)n2)cn1 |
| InChI | InChI=1S/C17H22N6O2/c1-11(2)20-16-15-14(18-10-22(3)17(15)24)7-13(21-16)12-8-19-23(9-12)5-6-25-4/h7-11H,5-6H2,1-4H3,(H,20,21) |
| InChIKey | DQXNKPCFIJCQKH-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 7-[1-(2-methoxyethyl)pyrazol-4-yl]-3-methyl-5-(propan-2-ylamino)pyrido[4,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[1-(2-methoxyethyl)pyrazol-4-yl]-3-methyl-5-(propan-2-ylamino)pyrido[4,3-d]pyrimidin-4-one?
The IUPAC name of 7-[1-(2-methoxyethyl)pyrazol-4-yl]-3-methyl-5-(propan-2-ylamino)pyrido[4,3-d]pyrimidin-4-one (CID 66959610) is 7-[1-(2-methoxyethyl)pyrazol-4-yl]-3-methyl-5-(propan-2-ylamino)pyrido[4,3-d]pyrimidin-4-one.
What is the SMILES notation for 7-[1-(2-methoxyethyl)pyrazol-4-yl]-3-methyl-5-(propan-2-ylamino)pyrido[4,3-d]pyrimidin-4-one?
The canonical SMILES for 7-[1-(2-methoxyethyl)pyrazol-4-yl]-3-methyl-5-(propan-2-ylamino)pyrido[4,3-d]pyrimidin-4-one is COCCn1cc(-c2cc3ncn(C)c(=O)c3c(NC(C)C)n2)cn1.
What is the InChIKey of 7-[1-(2-methoxyethyl)pyrazol-4-yl]-3-methyl-5-(propan-2-ylamino)pyrido[4,3-d]pyrimidin-4-one?
The InChIKey is DQXNKPCFIJCQKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N6O2/c1-11(2)20-16-15-14(18-10-22(3)17(15)24)7-13(21-16)12-8-19-23(9-12)5-6-25-4/h7-11H,5-6H2,1-4H3,(H,20,21).
What are the key properties of 7-[1-(2-methoxyethyl)pyrazol-4-yl]-3-methyl-5-(propan-2-ylamino)pyrido[4,3-d]pyrimidin-4-one?
7-[1-(2-methoxyethyl)pyrazol-4-yl]-3-methyl-5-(propan-2-ylamino)pyrido[4,3-d]pyrimidin-4-one has a molecular weight of 342.40 g/mol, XLogP of 1.66, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[1-(2-methoxyethyl)pyrazol-4-yl]-3-methyl-5-(propan-2-ylamino)pyrido[4,3-d]pyrimidin-4-one is sourced from PubChem (CID 66959610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).