C22H25FN2O — CID 66959800
(1R,9R,10R)-5-(2-fluoroanilino)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol (PubChem CID 66959800) has the molecular formula C22H25FN2O and a molecular weight of 352.45 g/mol. Its IUPAC name is (1R,9R,10R)-5-(2-fluoroanilino)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol.
| Compound Name | (1R,9R,10R)-5-(2-fluoroanilino)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol |
|---|---|
| PubChem CID | 66959800 |
| Molecular Formula | C22H25FN2O |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | (1R,9R,10R)-5-(2-fluoroanilino)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol |
| SMILES | Oc1cc2c(cc1Nc1ccccc1F)C[C@H]1NCC[C@@]23CCCC[C@@H]13 |
| InChI | InChI=1S/C22H25FN2O/c23-17-6-1-2-7-18(17)25-20-12-14-11-19-15-5-3-4-8-22(15,9-10-24-19)16(14)13-21(20)26/h1-2,6-7,12-13,15,19,24-26H,3-5,8-11H2/t15-,19+,22+/m0/s1 |
| InChIKey | QKLJWNJIMPLHBX-VQPPSCEASA-N |
| XLogP | 4.62 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|