C17H21N3O2 — CID 66959885
3,3,5-trimethyl-1-(2-methylpropyl)-2,4-dioxo-1,5-benzodiazepine-7-carbonitrile (PubChem CID 66959885) has the molecular formula C17H21N3O2 and a molecular weight of 299.37 g/mol. Its IUPAC name is 3,3,5-trimethyl-1-(2-methylpropyl)-2,4-dioxo-1,5-benzodiazepine-7-carbonitrile.
| Compound Name | 3,3,5-trimethyl-1-(2-methylpropyl)-2,4-dioxo-1,5-benzodiazepine-7-carbonitrile |
|---|---|
| PubChem CID | 66959885 |
| Molecular Formula | C17H21N3O2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | 3,3,5-trimethyl-1-(2-methylpropyl)-2,4-dioxo-1,5-benzodiazepine-7-carbonitrile |
| SMILES | CC(C)CN1C(=O)C(C)(C)C(=O)N(C)c2cc(C#N)ccc21 |
| InChI | InChI=1S/C17H21N3O2/c1-11(2)10-20-13-7-6-12(9-18)8-14(13)19(5)15(21)17(3,4)16(20)22/h6-8,11H,10H2,1-5H3 |
| InChIKey | SLYSXKBYUQWDIE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|