About 5-[(4-hydroxycyclohexyl)amino]-3-methyl-7-(pyrazin-2-ylamino)pyrido[4,3-d]pyrimidin-4-one
5-[(4-hydroxycyclohexyl)amino]-3-methyl-7-(pyrazin-2-ylamino)pyrido[4,3-d]pyrimidin-4-one (PubChem CID 66959898) has the molecular formula C18H21N7O2
and a molecular weight of 367.41 g/mol. Its IUPAC name is 5-[(4-hydroxycyclohexyl)amino]-3-methyl-7-(pyrazin-2-ylamino)pyrido[4,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 5-[(4-hydroxycyclohexyl)amino]-3-methyl-7-(pyrazin-2-ylamino)pyrido[4,3-d]pyrimidin-4-one |
| PubChem CID | 66959898 |
| Molecular Formula | C18H21N7O2 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 5-[(4-hydroxycyclohexyl)amino]-3-methyl-7-(pyrazin-2-ylamino)pyrido[4,3-d]pyrimidin-4-one |
| SMILES | Cn1cnc2cc(Nc3cnccn3)nc(NC3CCC(O)CC3)c2c1=O |
| InChI | InChI=1S/C18H21N7O2/c1-25-10-21-13-8-14(23-15-9-19-6-7-20-15)24-17(16(13)18(25)27)22-11-2-4-12(26)5-3-11/h6-12,26H,2-5H2,1H3,(H2,20,22,23,24) |
| InChIKey | HRMQVFHXNVFGLE-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 5-[(4-hydroxycyclohexyl)amino]-3-methyl-7-(pyrazin-2-ylamino)pyrido[4,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4-hydroxycyclohexyl)amino]-3-methyl-7-(pyrazin-2-ylamino)pyrido[4,3-d]pyrimidin-4-one?
The IUPAC name of 5-[(4-hydroxycyclohexyl)amino]-3-methyl-7-(pyrazin-2-ylamino)pyrido[4,3-d]pyrimidin-4-one (CID 66959898) is 5-[(4-hydroxycyclohexyl)amino]-3-methyl-7-(pyrazin-2-ylamino)pyrido[4,3-d]pyrimidin-4-one.
What is the SMILES notation for 5-[(4-hydroxycyclohexyl)amino]-3-methyl-7-(pyrazin-2-ylamino)pyrido[4,3-d]pyrimidin-4-one?
The canonical SMILES for 5-[(4-hydroxycyclohexyl)amino]-3-methyl-7-(pyrazin-2-ylamino)pyrido[4,3-d]pyrimidin-4-one is Cn1cnc2cc(Nc3cnccn3)nc(NC3CCC(O)CC3)c2c1=O.
What is the InChIKey of 5-[(4-hydroxycyclohexyl)amino]-3-methyl-7-(pyrazin-2-ylamino)pyrido[4,3-d]pyrimidin-4-one?
The InChIKey is HRMQVFHXNVFGLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N7O2/c1-25-10-21-13-8-14(23-15-9-19-6-7-20-15)24-17(16(13)18(25)27)22-11-2-4-12(26)5-3-11/h6-12,26H,2-5H2,1H3,(H2,20,22,23,24).
What are the key properties of 5-[(4-hydroxycyclohexyl)amino]-3-methyl-7-(pyrazin-2-ylamino)pyrido[4,3-d]pyrimidin-4-one?
5-[(4-hydroxycyclohexyl)amino]-3-methyl-7-(pyrazin-2-ylamino)pyrido[4,3-d]pyrimidin-4-one has a molecular weight of 367.41 g/mol, XLogP of 1.58, 4 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4-hydroxycyclohexyl)amino]-3-methyl-7-(pyrazin-2-ylamino)pyrido[4,3-d]pyrimidin-4-one is sourced from PubChem (CID 66959898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).