About azepine-2,4-dione;trihydrochloride
azepine-2,4-dione;trihydrochloride (PubChem CID 66959922) has the molecular formula C6H8Cl3NO2
and a molecular weight of 232.49 g/mol. Its IUPAC name is azepine-2,4-dione;trihydrochloride.
Molecular Properties
| Compound Name | azepine-2,4-dione;trihydrochloride |
| PubChem CID | 66959922 |
| Molecular Formula | C6H8Cl3NO2 |
| Molecular Weight | 232.49 g/mol |
| Exact Mass | 230.96 |
| IUPAC Name | azepine-2,4-dione;trihydrochloride |
| SMILES | Cl.Cl.Cl.O=C1C=CC=NC(=O)C1 |
| InChI | InChI=1S/C6H5NO2.3ClH/c8-5-2-1-3-7-6(9)4-5;;;/h1-3H,4H2;3*1H |
| InChIKey | GPNNPTGMURWSNZ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.49 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze azepine-2,4-dione;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azepine-2,4-dione;trihydrochloride?
The IUPAC name of azepine-2,4-dione;trihydrochloride (CID 66959922) is azepine-2,4-dione;trihydrochloride.
What is the SMILES notation for azepine-2,4-dione;trihydrochloride?
The canonical SMILES for azepine-2,4-dione;trihydrochloride is Cl.Cl.Cl.O=C1C=CC=NC(=O)C1.
What is the InChIKey of azepine-2,4-dione;trihydrochloride?
The InChIKey is GPNNPTGMURWSNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO2.3ClH/c8-5-2-1-3-7-6(9)4-5;;;/h1-3H,4H2;3*1H.
What are the key properties of azepine-2,4-dione;trihydrochloride?
azepine-2,4-dione;trihydrochloride has a molecular weight of 232.49 g/mol, XLogP of 1.38, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azepine-2,4-dione;trihydrochloride is sourced from PubChem (CID 66959922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).