About 3-methyl-5,7-bis(4-morpholin-4-ylphenyl)pyrido[4,3-d]pyrimidin-4-one
3-methyl-5,7-bis(4-morpholin-4-ylphenyl)pyrido[4,3-d]pyrimidin-4-one (PubChem CID 66959982) has the molecular formula C28H29N5O3
and a molecular weight of 483.57 g/mol. Its IUPAC name is 3-methyl-5,7-bis(4-morpholin-4-ylphenyl)pyrido[4,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 3-methyl-5,7-bis(4-morpholin-4-ylphenyl)pyrido[4,3-d]pyrimidin-4-one |
| PubChem CID | 66959982 |
| Molecular Formula | C28H29N5O3 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | 3-methyl-5,7-bis(4-morpholin-4-ylphenyl)pyrido[4,3-d]pyrimidin-4-one |
| SMILES | Cn1cnc2cc(-c3ccc(N4CCOCC4)cc3)nc(-c3ccc(N4CCOCC4)cc3)c2c1=O |
| InChI | InChI=1S/C28H29N5O3/c1-31-19-29-25-18-24(20-2-6-22(7-3-20)32-10-14-35-15-11-32)30-27(26(25)28(31)34)21-4-8-23(9-5-21)33-12-16-36-17-13-33/h2-9,18-19H,10-17H2,1H3 |
| InChIKey | PUUXWHIPRVWSFH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 72.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 3-methyl-5,7-bis(4-morpholin-4-ylphenyl)pyrido[4,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5,7-bis(4-morpholin-4-ylphenyl)pyrido[4,3-d]pyrimidin-4-one?
The IUPAC name of 3-methyl-5,7-bis(4-morpholin-4-ylphenyl)pyrido[4,3-d]pyrimidin-4-one (CID 66959982) is 3-methyl-5,7-bis(4-morpholin-4-ylphenyl)pyrido[4,3-d]pyrimidin-4-one.
What is the SMILES notation for 3-methyl-5,7-bis(4-morpholin-4-ylphenyl)pyrido[4,3-d]pyrimidin-4-one?
The canonical SMILES for 3-methyl-5,7-bis(4-morpholin-4-ylphenyl)pyrido[4,3-d]pyrimidin-4-one is Cn1cnc2cc(-c3ccc(N4CCOCC4)cc3)nc(-c3ccc(N4CCOCC4)cc3)c2c1=O.
What is the InChIKey of 3-methyl-5,7-bis(4-morpholin-4-ylphenyl)pyrido[4,3-d]pyrimidin-4-one?
The InChIKey is PUUXWHIPRVWSFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H29N5O3/c1-31-19-29-25-18-24(20-2-6-22(7-3-20)32-10-14-35-15-11-32)30-27(26(25)28(31)34)21-4-8-23(9-5-21)33-12-16-36-17-13-33/h2-9,18-19H,10-17H2,1H3.
What are the key properties of 3-methyl-5,7-bis(4-morpholin-4-ylphenyl)pyrido[4,3-d]pyrimidin-4-one?
3-methyl-5,7-bis(4-morpholin-4-ylphenyl)pyrido[4,3-d]pyrimidin-4-one has a molecular weight of 483.57 g/mol, XLogP of 3.34, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5,7-bis(4-morpholin-4-ylphenyl)pyrido[4,3-d]pyrimidin-4-one is sourced from PubChem (CID 66959982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).