C23H25F3N2O2 — CID 66960335
(1R,9R,10R)-5-[2-(trifluoromethoxy)anilino]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol (PubChem CID 66960335) has the molecular formula C23H25F3N2O2 and a molecular weight of 418.46 g/mol. Its IUPAC name is (1R,9R,10R)-5-[2-(trifluoromethoxy)anilino]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol.
| Compound Name | (1R,9R,10R)-5-[2-(trifluoromethoxy)anilino]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol |
|---|---|
| PubChem CID | 66960335 |
| Molecular Formula | C23H25F3N2O2 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | (1R,9R,10R)-5-[2-(trifluoromethoxy)anilino]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-4-ol |
| SMILES | Oc1cc2c(cc1Nc1ccccc1OC(F)(F)F)C[C@H]1NCC[C@@]23CCCC[C@@H]13 |
| InChI | InChI=1S/C23H25F3N2O2/c24-23(25,26)30-21-7-2-1-6-17(21)28-19-12-14-11-18-15-5-3-4-8-22(15,9-10-27-18)16(14)13-20(19)29/h1-2,6-7,12-13,15,18,27-29H,3-5,8-11H2/t15-,18+,22+/m0/s1 |
| InChIKey | MIUIEFPVHXMDSG-QXATTWAWSA-N |
| XLogP | 5.38 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|