C28H31N5O4S — CID 66960439
1-ethyl-3,3,5-trimethyl-7-[[2-(4-oxofuro[3,2-c]pyridin-5-yl)ethyl-(1,3-thiazol-2-ylmethyl)amino]methyl]-1,5-benzodiazepine-2,4-dione (PubChem CID 66960439) has the molecular formula C28H31N5O4S and a molecular weight of 533.65 g/mol. Its IUPAC name is 1-ethyl-3,3,5-trimethyl-7-[[2-(4-oxofuro[3,2-c]pyridin-5-yl)ethyl-(1,3-thiazol-2-ylmethyl)amino]methyl]-1,5-benzodiazepine-2,4-dione.
| Compound Name | 1-ethyl-3,3,5-trimethyl-7-[[2-(4-oxofuro[3,2-c]pyridin-5-yl)ethyl-(1,3-thiazol-2-ylmethyl)amino]methyl]-1,5-benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 66960439 |
| Molecular Formula | C28H31N5O4S |
| Molecular Weight | 533.65 g/mol |
| Exact Mass | 533.21 |
| IUPAC Name | 1-ethyl-3,3,5-trimethyl-7-[[2-(4-oxofuro[3,2-c]pyridin-5-yl)ethyl-(1,3-thiazol-2-ylmethyl)amino]methyl]-1,5-benzodiazepine-2,4-dione |
| SMILES | CCN1C(=O)C(C)(C)C(=O)N(C)c2cc(CN(CCn3ccc4occc4c3=O)Cc3nccs3)ccc21 |
| InChI | InChI=1S/C28H31N5O4S/c1-5-33-21-7-6-19(16-22(21)30(4)26(35)28(2,3)27(33)36)17-31(18-24-29-10-15-38-24)12-13-32-11-8-23-20(25(32)34)9-14-37-23/h6-11,14-16H,5,12-13,17-18H2,1-4H3 |
| InChIKey | HGLRXRSNEWSRHV-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 91.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.65 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|