C31H37N5O4S — CID 66960475
7-[[(4,5-dimethyl-1,3-thiazol-2-yl)methyl-[2-(2-methyl-4-oxofuro[3,2-c]pyridin-5-yl)ethyl]amino]methyl]-1-ethyl-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione (PubChem CID 66960475) has the molecular formula C31H37N5O4S and a molecular weight of 575.74 g/mol. Its IUPAC name is 7-[[(4,5-dimethyl-1,3-thiazol-2-yl)methyl-[2-(2-methyl-4-oxofuro[3,2-c]pyridin-5-yl)ethyl]amino]methyl]-1-ethyl-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione.
| Compound Name | 7-[[(4,5-dimethyl-1,3-thiazol-2-yl)methyl-[2-(2-methyl-4-oxofuro[3,2-c]pyridin-5-yl)ethyl]amino]methyl]-1-ethyl-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 66960475 |
| Molecular Formula | C31H37N5O4S |
| Molecular Weight | 575.74 g/mol |
| Exact Mass | 575.26 |
| IUPAC Name | 7-[[(4,5-dimethyl-1,3-thiazol-2-yl)methyl-[2-(2-methyl-4-oxofuro[3,2-c]pyridin-5-yl)ethyl]amino]methyl]-1-ethyl-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione |
| SMILES | CCN1C(=O)C(C)(C)C(=O)N(C)c2cc(CN(CCn3ccc4oc(C)cc4c3=O)Cc3nc(C)c(C)s3)ccc21 |
| InChI | InChI=1S/C31H37N5O4S/c1-8-36-24-10-9-22(16-25(24)33(7)29(38)31(5,6)30(36)39)17-34(18-27-32-20(3)21(4)41-27)13-14-35-12-11-26-23(28(35)37)15-19(2)40-26/h9-12,15-16H,8,13-14,17-18H2,1-7H3 |
| InChIKey | OJVXPTJYUOCXBK-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 91.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.74 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|