C15H17N3O2 — CID 66960477
1-ethyl-3,3,5-trimethyl-2,4-dioxo-1,5-benzodiazepine-7-carbonitrile (PubChem CID 66960477) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is 1-ethyl-3,3,5-trimethyl-2,4-dioxo-1,5-benzodiazepine-7-carbonitrile.
| Compound Name | 1-ethyl-3,3,5-trimethyl-2,4-dioxo-1,5-benzodiazepine-7-carbonitrile |
|---|---|
| PubChem CID | 66960477 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 1-ethyl-3,3,5-trimethyl-2,4-dioxo-1,5-benzodiazepine-7-carbonitrile |
| SMILES | CCN1C(=O)C(C)(C)C(=O)N(C)c2cc(C#N)ccc21 |
| InChI | InChI=1S/C15H17N3O2/c1-5-18-11-7-6-10(9-16)8-12(11)17(4)13(19)15(2,3)14(18)20/h6-8H,5H2,1-4H3 |
| InChIKey | PBQSPIBDEOUJNI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|