C19H21N3O2 — CID 66960487
5-cyclopropyl-1-(cyclopropylmethyl)-3,3-dimethyl-2,4-dioxo-1,5-benzodiazepine-7-carbonitrile (PubChem CID 66960487) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 5-cyclopropyl-1-(cyclopropylmethyl)-3,3-dimethyl-2,4-dioxo-1,5-benzodiazepine-7-carbonitrile.
| Compound Name | 5-cyclopropyl-1-(cyclopropylmethyl)-3,3-dimethyl-2,4-dioxo-1,5-benzodiazepine-7-carbonitrile |
|---|---|
| PubChem CID | 66960487 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 5-cyclopropyl-1-(cyclopropylmethyl)-3,3-dimethyl-2,4-dioxo-1,5-benzodiazepine-7-carbonitrile |
| SMILES | CC1(C)C(=O)N(CC2CC2)c2ccc(C#N)cc2N(C2CC2)C1=O |
| InChI | InChI=1S/C19H21N3O2/c1-19(2)17(23)21(11-12-3-4-12)15-8-5-13(10-20)9-16(15)22(18(19)24)14-6-7-14/h5,8-9,12,14H,3-4,6-7,11H2,1-2H3 |
| InChIKey | LUMRSAJAVNSLKE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|