C22H26N2O3 — CID 66960731
4-[[(1R,9R,10R)-4-hydroxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-5-yl]amino]benzene-1,3-diol (PubChem CID 66960731) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is 4-[[(1R,9R,10R)-4-hydroxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-5-yl]amino]benzene-1,3-diol.
| Compound Name | 4-[[(1R,9R,10R)-4-hydroxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-5-yl]amino]benzene-1,3-diol |
|---|---|
| PubChem CID | 66960731 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 4-[[(1R,9R,10R)-4-hydroxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-trien-5-yl]amino]benzene-1,3-diol |
| SMILES | Oc1ccc(Nc2cc3c(cc2O)[C@@]24CCCC[C@H]2[C@@H](C3)NCC4)c(O)c1 |
| InChI | InChI=1S/C22H26N2O3/c25-14-4-5-17(20(26)11-14)24-19-10-13-9-18-15-3-1-2-6-22(15,7-8-23-18)16(13)12-21(19)27/h4-5,10-12,15,18,23-27H,1-3,6-9H2/t15-,18+,22+/m0/s1 |
| InChIKey | XRRURLZLNJRDLY-QXATTWAWSA-N |
| XLogP | 3.89 |
| TPSA | 84.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|