C30H34N4O4S — CID 66960860
1-ethyl-3,3,5-trimethyl-7-[[(3-methylthiophen-2-yl)methyl-[2-(4-oxofuro[3,2-c]pyridin-5-yl)ethyl]amino]methyl]-1,5-benzodiazepine-2,4-dione (PubChem CID 66960860) has the molecular formula C30H34N4O4S and a molecular weight of 546.69 g/mol. Its IUPAC name is 1-ethyl-3,3,5-trimethyl-7-[[(3-methylthiophen-2-yl)methyl-[2-(4-oxofuro[3,2-c]pyridin-5-yl)ethyl]amino]methyl]-1,5-benzodiazepine-2,4-dione.
| Compound Name | 1-ethyl-3,3,5-trimethyl-7-[[(3-methylthiophen-2-yl)methyl-[2-(4-oxofuro[3,2-c]pyridin-5-yl)ethyl]amino]methyl]-1,5-benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 66960860 |
| Molecular Formula | C30H34N4O4S |
| Molecular Weight | 546.69 g/mol |
| Exact Mass | 546.23 |
| IUPAC Name | 1-ethyl-3,3,5-trimethyl-7-[[(3-methylthiophen-2-yl)methyl-[2-(4-oxofuro[3,2-c]pyridin-5-yl)ethyl]amino]methyl]-1,5-benzodiazepine-2,4-dione |
| SMILES | CCN1C(=O)C(C)(C)C(=O)N(C)c2cc(CN(CCn3ccc4occc4c3=O)Cc3sccc3C)ccc21 |
| InChI | InChI=1S/C30H34N4O4S/c1-6-34-23-8-7-21(17-24(23)31(5)28(36)30(3,4)29(34)37)18-32(19-26-20(2)11-16-39-26)13-14-33-12-9-25-22(27(33)35)10-15-38-25/h7-12,15-17H,6,13-14,18-19H2,1-5H3 |
| InChIKey | PQUUFCHQOWKVHI-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 79.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.69 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|