C30H31F3N4O5 — CID 66960878
1-ethyl-3,3,5-trimethyl-7-[[2-(4-oxofuro[3,2-c]pyridin-5-yl)ethyl-[[5-(trifluoromethyl)furan-2-yl]methyl]amino]methyl]-1,5-benzodiazepine-2,4-dione (PubChem CID 66960878) has the molecular formula C30H31F3N4O5 and a molecular weight of 584.60 g/mol. Its IUPAC name is 1-ethyl-3,3,5-trimethyl-7-[[2-(4-oxofuro[3,2-c]pyridin-5-yl)ethyl-[[5-(trifluoromethyl)furan-2-yl]methyl]amino]methyl]-1,5-benzodiazepine-2,4-dione.
| Compound Name | 1-ethyl-3,3,5-trimethyl-7-[[2-(4-oxofuro[3,2-c]pyridin-5-yl)ethyl-[[5-(trifluoromethyl)furan-2-yl]methyl]amino]methyl]-1,5-benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 66960878 |
| Molecular Formula | C30H31F3N4O5 |
| Molecular Weight | 584.60 g/mol |
| Exact Mass | 584.22 |
| IUPAC Name | 1-ethyl-3,3,5-trimethyl-7-[[2-(4-oxofuro[3,2-c]pyridin-5-yl)ethyl-[[5-(trifluoromethyl)furan-2-yl]methyl]amino]methyl]-1,5-benzodiazepine-2,4-dione |
| SMILES | CCN1C(=O)C(C)(C)C(=O)N(C)c2cc(CN(CCn3ccc4occc4c3=O)Cc3ccc(C(F)(F)F)o3)ccc21 |
| InChI | InChI=1S/C30H31F3N4O5/c1-5-37-22-8-6-19(16-23(22)34(4)27(39)29(2,3)28(37)40)17-35(18-20-7-9-25(42-20)30(31,32)33)13-14-36-12-10-24-21(26(36)38)11-15-41-24/h6-12,15-16H,5,13-14,17-18H2,1-4H3 |
| InChIKey | LZUCFFORAUIANT-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 92.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.60 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|