C36H44N6O4 — CID 66961014
1-ethyl-7-[[(1-ethyl-3,3,5-trimethyl-2,4-dioxo-1,5-benzodiazepin-7-yl)methyl-(pyridin-4-ylmethyl)amino]methyl]-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione (PubChem CID 66961014) has the molecular formula C36H44N6O4 and a molecular weight of 624.79 g/mol. Its IUPAC name is 1-ethyl-7-[[(1-ethyl-3,3,5-trimethyl-2,4-dioxo-1,5-benzodiazepin-7-yl)methyl-(pyridin-4-ylmethyl)amino]methyl]-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione.
| Compound Name | 1-ethyl-7-[[(1-ethyl-3,3,5-trimethyl-2,4-dioxo-1,5-benzodiazepin-7-yl)methyl-(pyridin-4-ylmethyl)amino]methyl]-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 66961014 |
| Molecular Formula | C36H44N6O4 |
| Molecular Weight | 624.79 g/mol |
| Exact Mass | 624.34 |
| IUPAC Name | 1-ethyl-7-[[(1-ethyl-3,3,5-trimethyl-2,4-dioxo-1,5-benzodiazepin-7-yl)methyl-(pyridin-4-ylmethyl)amino]methyl]-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione |
| SMILES | CCN1C(=O)C(C)(C)C(=O)N(C)c2cc(CN(Cc3ccncc3)Cc3ccc4c(c3)N(C)C(=O)C(C)(C)C(=O)N4CC)ccc21 |
| InChI | InChI=1S/C36H44N6O4/c1-9-41-27-13-11-25(19-29(27)38(7)31(43)35(3,4)33(41)45)22-40(21-24-15-17-37-18-16-24)23-26-12-14-28-30(20-26)39(8)32(44)36(5,6)34(46)42(28)10-2/h11-20H,9-10,21-23H2,1-8H3 |
| InChIKey | UUUDKRZOOWYABP-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 97.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.79 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|