C16H19N3O2 — CID 66961020
3,3-dimethyl-1-(2-methylpropyl)-2,4-dioxo-5H-1,5-benzodiazepine-7-carbonitrile (PubChem CID 66961020) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 3,3-dimethyl-1-(2-methylpropyl)-2,4-dioxo-5H-1,5-benzodiazepine-7-carbonitrile.
| Compound Name | 3,3-dimethyl-1-(2-methylpropyl)-2,4-dioxo-5H-1,5-benzodiazepine-7-carbonitrile |
|---|---|
| PubChem CID | 66961020 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 3,3-dimethyl-1-(2-methylpropyl)-2,4-dioxo-5H-1,5-benzodiazepine-7-carbonitrile |
| SMILES | CC(C)CN1C(=O)C(C)(C)C(=O)Nc2cc(C#N)ccc21 |
| InChI | InChI=1S/C16H19N3O2/c1-10(2)9-19-13-6-5-11(8-17)7-12(13)18-14(20)16(3,4)15(19)21/h5-7,10H,9H2,1-4H3,(H,18,20) |
| InChIKey | PRQBMBXEGMWWMD-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|