C33H39N5O4 — CID 66961154
7-[[2-(2,7-dimethyl-4-oxofuro[3,2-c]pyridin-5-yl)ethyl-[(4-methyl-3-pyridinyl)methyl]amino]methyl]-1-ethyl-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione (PubChem CID 66961154) has the molecular formula C33H39N5O4 and a molecular weight of 569.71 g/mol. Its IUPAC name is 7-[[2-(2,7-dimethyl-4-oxofuro[3,2-c]pyridin-5-yl)ethyl-[(4-methyl-3-pyridinyl)methyl]amino]methyl]-1-ethyl-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione.
| Compound Name | 7-[[2-(2,7-dimethyl-4-oxofuro[3,2-c]pyridin-5-yl)ethyl-[(4-methyl-3-pyridinyl)methyl]amino]methyl]-1-ethyl-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 66961154 |
| Molecular Formula | C33H39N5O4 |
| Molecular Weight | 569.71 g/mol |
| Exact Mass | 569.30 |
| IUPAC Name | 7-[[2-(2,7-dimethyl-4-oxofuro[3,2-c]pyridin-5-yl)ethyl-[(4-methyl-3-pyridinyl)methyl]amino]methyl]-1-ethyl-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione |
| SMILES | CCN1C(=O)C(C)(C)C(=O)N(C)c2cc(CN(CCn3cc(C)c4oc(C)cc4c3=O)Cc3cnccc3C)ccc21 |
| InChI | InChI=1S/C33H39N5O4/c1-8-38-27-10-9-24(16-28(27)35(7)31(40)33(5,6)32(38)41)19-36(20-25-17-34-12-11-21(25)2)13-14-37-18-22(3)29-26(30(37)39)15-23(4)42-29/h9-12,15-18H,8,13-14,19-20H2,1-7H3 |
| InChIKey | DCWSPWXXEUTYBQ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 91.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.71 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|