C25H27N3O5 — CID 66961177
7-[3-(2,3-dioxoindol-1-yl)propoxy]-1-ethyl-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione (PubChem CID 66961177) has the molecular formula C25H27N3O5 and a molecular weight of 449.51 g/mol. Its IUPAC name is 7-[3-(2,3-dioxoindol-1-yl)propoxy]-1-ethyl-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione.
| Compound Name | 7-[3-(2,3-dioxoindol-1-yl)propoxy]-1-ethyl-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 66961177 |
| Molecular Formula | C25H27N3O5 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 7-[3-(2,3-dioxoindol-1-yl)propoxy]-1-ethyl-3,3,5-trimethyl-1,5-benzodiazepine-2,4-dione |
| SMILES | CCN1C(=O)C(C)(C)C(=O)N(C)c2cc(OCCCN3C(=O)C(=O)c4ccccc43)ccc21 |
| InChI | InChI=1S/C25H27N3O5/c1-5-27-19-12-11-16(15-20(19)26(4)23(31)25(2,3)24(27)32)33-14-8-13-28-18-10-7-6-9-17(18)21(29)22(28)30/h6-7,9-12,15H,5,8,13-14H2,1-4H3 |
| InChIKey | MHUUXKJFTHCVLX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|