C23H50OSi2 — CID 66961599
2,2,3,3-tetraethyl-6,6-dihexyloxadisilinane (PubChem CID 66961599) has the molecular formula C23H50OSi2 and a molecular weight of 398.82 g/mol. Its IUPAC name is 2,2,3,3-tetraethyl-6,6-dihexyloxadisilinane.
| Compound Name | 2,2,3,3-tetraethyl-6,6-dihexyloxadisilinane |
|---|---|
| PubChem CID | 66961599 |
| Molecular Formula | C23H50OSi2 |
| Molecular Weight | 398.82 g/mol |
| Exact Mass | 398.34 |
| IUPAC Name | 2,2,3,3-tetraethyl-6,6-dihexyloxadisilinane |
| SMILES | CCCCCCC1(CCCCCC)CC[Si](CC)(CC)[Si](CC)(CC)O1 |
| InChI | InChI=1S/C23H50OSi2/c1-7-13-15-17-19-23(20-18-16-14-8-2)21-22-25(9-3,10-4)26(11-5,12-6)24-23/h7-22H2,1-6H3 |
| InChIKey | ZUBWMMOPNLDLHE-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.82 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|