C19H42OSi2 — CID 66962213
6,6-dibutyl-2,2,3,3-tetraethyloxadisilinane (PubChem CID 66962213) has the molecular formula C19H42OSi2 and a molecular weight of 342.72 g/mol. Its IUPAC name is 6,6-dibutyl-2,2,3,3-tetraethyloxadisilinane.
| Compound Name | 6,6-dibutyl-2,2,3,3-tetraethyloxadisilinane |
|---|---|
| PubChem CID | 66962213 |
| Molecular Formula | C19H42OSi2 |
| Molecular Weight | 342.72 g/mol |
| Exact Mass | 342.28 |
| IUPAC Name | 6,6-dibutyl-2,2,3,3-tetraethyloxadisilinane |
| SMILES | CCCCC1(CCCC)CC[Si](CC)(CC)[Si](CC)(CC)O1 |
| InChI | InChI=1S/C19H42OSi2/c1-7-13-15-19(16-14-8-2)17-18-21(9-3,10-4)22(11-5,12-6)20-19/h7-18H2,1-6H3 |
| InChIKey | RHIMRYBDNROTOW-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.72 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|