C26H35N5O — CID 66962333
2-benzyl-N,N-dimethyl-1-(4-morpholin-4-ylphenyl)butan-2-amine;1,3,5-triazine (PubChem CID 66962333) has the molecular formula C26H35N5O and a molecular weight of 433.60 g/mol. Its IUPAC name is 2-benzyl-N,N-dimethyl-1-(4-morpholin-4-ylphenyl)butan-2-amine;1,3,5-triazine.
| Compound Name | 2-benzyl-N,N-dimethyl-1-(4-morpholin-4-ylphenyl)butan-2-amine;1,3,5-triazine |
|---|---|
| PubChem CID | 66962333 |
| Molecular Formula | C26H35N5O |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.28 |
| IUPAC Name | 2-benzyl-N,N-dimethyl-1-(4-morpholin-4-ylphenyl)butan-2-amine;1,3,5-triazine |
| SMILES | CCC(Cc1ccccc1)(Cc1ccc(N2CCOCC2)cc1)N(C)C.c1ncncn1 |
| InChI | InChI=1S/C23H32N2O.C3H3N3/c1-4-23(24(2)3,18-20-8-6-5-7-9-20)19-21-10-12-22(13-11-21)25-14-16-26-17-15-25;1-4-2-6-3-5-1/h5-13H,4,14-19H2,1-3H3;1-3H |
| InChIKey | BECPSLIAGHVBTL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 54.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|