C17H38OSi2 — CID 66962532
2,2,3,3-tetraethyl-6,6-dipropyloxadisilinane (PubChem CID 66962532) has the molecular formula C17H38OSi2 and a molecular weight of 314.66 g/mol. Its IUPAC name is 2,2,3,3-tetraethyl-6,6-dipropyloxadisilinane.
| Compound Name | 2,2,3,3-tetraethyl-6,6-dipropyloxadisilinane |
|---|---|
| PubChem CID | 66962532 |
| Molecular Formula | C17H38OSi2 |
| Molecular Weight | 314.66 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | 2,2,3,3-tetraethyl-6,6-dipropyloxadisilinane |
| SMILES | CCCC1(CCC)CC[Si](CC)(CC)[Si](CC)(CC)O1 |
| InChI | InChI=1S/C17H38OSi2/c1-7-13-17(14-8-2)15-16-19(9-3,10-4)20(11-5,12-6)18-17/h7-16H2,1-6H3 |
| InChIKey | XXWPGVYOJDVMHK-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.66 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|