C21H46OSi2 — CID 66962534
2,2,3,3-tetraethyl-6,6-dipentyloxadisilinane (PubChem CID 66962534) has the molecular formula C21H46OSi2 and a molecular weight of 370.77 g/mol. Its IUPAC name is 2,2,3,3-tetraethyl-6,6-dipentyloxadisilinane.
| Compound Name | 2,2,3,3-tetraethyl-6,6-dipentyloxadisilinane |
|---|---|
| PubChem CID | 66962534 |
| Molecular Formula | C21H46OSi2 |
| Molecular Weight | 370.77 g/mol |
| Exact Mass | 370.31 |
| IUPAC Name | 2,2,3,3-tetraethyl-6,6-dipentyloxadisilinane |
| SMILES | CCCCCC1(CCCCC)CC[Si](CC)(CC)[Si](CC)(CC)O1 |
| InChI | InChI=1S/C21H46OSi2/c1-7-13-15-17-21(18-16-14-8-2)19-20-23(9-3,10-4)24(11-5,12-6)22-21/h7-20H2,1-6H3 |
| InChIKey | JUOMFZYHYLLACG-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.77 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|