C13H30OSi2 — CID 66962549
2,2,3,3-tetramethyl-6,6-dipropyloxadisilinane (PubChem CID 66962549) has the molecular formula C13H30OSi2 and a molecular weight of 258.55 g/mol. Its IUPAC name is 2,2,3,3-tetramethyl-6,6-dipropyloxadisilinane.
| Compound Name | 2,2,3,3-tetramethyl-6,6-dipropyloxadisilinane |
|---|---|
| PubChem CID | 66962549 |
| Molecular Formula | C13H30OSi2 |
| Molecular Weight | 258.55 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 2,2,3,3-tetramethyl-6,6-dipropyloxadisilinane |
| SMILES | CCCC1(CCC)CC[Si](C)(C)[Si](C)(C)O1 |
| InChI | InChI=1S/C13H30OSi2/c1-7-9-13(10-8-2)11-12-15(3,4)16(5,6)14-13/h7-12H2,1-6H3 |
| InChIKey | RVJIAAKXXBGVBC-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.55 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|