C23H18FN5O2 — CID 66962669
N-[1-(4-fluorophenyl)-2,2-dipyridin-3-ylethyl]-3-nitropyridin-2-amine (PubChem CID 66962669) has the molecular formula C23H18FN5O2 and a molecular weight of 415.43 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)-2,2-dipyridin-3-ylethyl]-3-nitropyridin-2-amine.
| Compound Name | N-[1-(4-fluorophenyl)-2,2-dipyridin-3-ylethyl]-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 66962669 |
| Molecular Formula | C23H18FN5O2 |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | N-[1-(4-fluorophenyl)-2,2-dipyridin-3-ylethyl]-3-nitropyridin-2-amine |
| SMILES | O=[N+]([O-])c1cccnc1NC(c1ccc(F)cc1)C(c1cccnc1)c1cccnc1 |
| InChI | InChI=1S/C23H18FN5O2/c24-19-9-7-16(8-10-19)22(28-23-20(29(30)31)6-3-13-27-23)21(17-4-1-11-25-14-17)18-5-2-12-26-15-18/h1-15,21-22H,(H,27,28) |
| InChIKey | QIQLNNFUUOWYIZ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|