About 3-pentylpyrazolo[1,5-a]pyrimidine
3-pentylpyrazolo[1,5-a]pyrimidine (PubChem CID 66962823) has the molecular formula C11H15N3
and a molecular weight of 189.26 g/mol. Its IUPAC name is 3-pentylpyrazolo[1,5-a]pyrimidine.
Molecular Properties
| Compound Name | 3-pentylpyrazolo[1,5-a]pyrimidine |
| PubChem CID | 66962823 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 3-pentylpyrazolo[1,5-a]pyrimidine |
| SMILES | CCCCCc1cnn2cccnc12 |
| InChI | InChI=1S/C11H15N3/c1-2-3-4-6-10-9-13-14-8-5-7-12-11(10)14/h5,7-9H,2-4,6H2,1H3 |
| InChIKey | JCVUBCFIAGTLBG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-pentylpyrazolo[1,5-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pentylpyrazolo[1,5-a]pyrimidine?
The IUPAC name of 3-pentylpyrazolo[1,5-a]pyrimidine (CID 66962823) is 3-pentylpyrazolo[1,5-a]pyrimidine.
What is the SMILES notation for 3-pentylpyrazolo[1,5-a]pyrimidine?
The canonical SMILES for 3-pentylpyrazolo[1,5-a]pyrimidine is CCCCCc1cnn2cccnc12.
What is the InChIKey of 3-pentylpyrazolo[1,5-a]pyrimidine?
The InChIKey is JCVUBCFIAGTLBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3/c1-2-3-4-6-10-9-13-14-8-5-7-12-11(10)14/h5,7-9H,2-4,6H2,1H3.
What are the key properties of 3-pentylpyrazolo[1,5-a]pyrimidine?
3-pentylpyrazolo[1,5-a]pyrimidine has a molecular weight of 189.26 g/mol, XLogP of 2.46, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pentylpyrazolo[1,5-a]pyrimidine is sourced from PubChem (CID 66962823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).