C28H36BrN3O6 — CID 66963109
ethyl (3R,5S,8S)-16-bromo-8-tert-butyl-7,10-dioxo-2,11-dioxa-6,9,23-triazatetracyclo[15.6.2.13,6.020,24]hexacosa-1(23),17(25),18,20(24),21-pentaene-5-carboxylate (PubChem CID 66963109) has the molecular formula C28H36BrN3O6 and a molecular weight of 590.52 g/mol. Its IUPAC name is ethyl (3R,5S,8S)-16-bromo-8-tert-butyl-7,10-dioxo-2,11-dioxa-6,9,23-triazatetracyclo[15.6.2.13,6.020,24]hexacosa-1(23),17(25),18,20(24),21-pentaene-5-carboxylate.
| Compound Name | ethyl (3R,5S,8S)-16-bromo-8-tert-butyl-7,10-dioxo-2,11-dioxa-6,9,23-triazatetracyclo[15.6.2.13,6.020,24]hexacosa-1(23),17(25),18,20(24),21-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 66963109 |
| Molecular Formula | C28H36BrN3O6 |
| Molecular Weight | 590.52 g/mol |
| Exact Mass | 589.18 |
| IUPAC Name | ethyl (3R,5S,8S)-16-bromo-8-tert-butyl-7,10-dioxo-2,11-dioxa-6,9,23-triazatetracyclo[15.6.2.13,6.020,24]hexacosa-1(23),17(25),18,20(24),21-pentaene-5-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@@H]2CN1C(=O)[C@H](C(C)(C)C)NC(=O)OCCCCC(Br)c1ccc3ccnc(c3c1)O2 |
| InChI | InChI=1S/C28H36BrN3O6/c1-5-36-26(34)22-15-19-16-32(22)25(33)23(28(2,3)4)31-27(35)37-13-7-6-8-21(29)18-10-9-17-11-12-30-24(38-19)20(17)14-18/h9-12,14,19,21-23H,5-8,13,15-16H2,1-4H3,(H,31,35)/t19-,21?,22+,23-/m1/s1 |
| InChIKey | ZDGQGUQLYQFCRJ-YQAIZRMESA-N |
| XLogP | 4.91 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.52 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|