C13H20O — CID 66963592
1,4,4,7a-tetramethyl-2,5-dihydro-1H-inden-2-ol (PubChem CID 66963592) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is 1,4,4,7a-tetramethyl-2,5-dihydro-1H-inden-2-ol.
| Compound Name | 1,4,4,7a-tetramethyl-2,5-dihydro-1H-inden-2-ol |
|---|---|
| PubChem CID | 66963592 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | 1,4,4,7a-tetramethyl-2,5-dihydro-1H-inden-2-ol |
| SMILES | CC1C(O)C=C2C(C)(C)CC=CC21C |
| InChI | InChI=1S/C13H20O/c1-9-10(14)8-11-12(2,3)6-5-7-13(9,11)4/h5,7-10,14H,6H2,1-4H3 |
| InChIKey | MHUYBIUXLMLCJM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|