C26H25F3N4O2 — CID 66964301
N-(2-methoxyethyl)-2-methyl-3-phenyl-2-[3-[4-(trifluoromethyl)phenyl]pyrazolo[1,5-a]pyrimidin-7-yl]propanamide (PubChem CID 66964301) has the molecular formula C26H25F3N4O2 and a molecular weight of 482.51 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-methyl-3-phenyl-2-[3-[4-(trifluoromethyl)phenyl]pyrazolo[1,5-a]pyrimidin-7-yl]propanamide.
| Compound Name | N-(2-methoxyethyl)-2-methyl-3-phenyl-2-[3-[4-(trifluoromethyl)phenyl]pyrazolo[1,5-a]pyrimidin-7-yl]propanamide |
|---|---|
| PubChem CID | 66964301 |
| Molecular Formula | C26H25F3N4O2 |
| Molecular Weight | 482.51 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | N-(2-methoxyethyl)-2-methyl-3-phenyl-2-[3-[4-(trifluoromethyl)phenyl]pyrazolo[1,5-a]pyrimidin-7-yl]propanamide |
| SMILES | COCCNC(=O)C(C)(Cc1ccccc1)c1ccnc2c(-c3ccc(C(F)(F)F)cc3)cnn12 |
| InChI | InChI=1S/C26H25F3N4O2/c1-25(24(34)31-14-15-35-2,16-18-6-4-3-5-7-18)22-12-13-30-23-21(17-32-33(22)23)19-8-10-20(11-9-19)26(27,28)29/h3-13,17H,14-16H2,1-2H3,(H,31,34) |
| InChIKey | UHPLFHJLINDRRH-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.51 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|