C12H13N3OS — CID 66965420
1-phenyl-6,8,9,9a-tetrahydro-3H-[1,3]thiazino[3,4-d][1,2,4]triazin-4-one (PubChem CID 66965420) has the molecular formula C12H13N3OS and a molecular weight of 247.32 g/mol. Its IUPAC name is 1-phenyl-6,8,9,9a-tetrahydro-3H-[1,3]thiazino[3,4-d][1,2,4]triazin-4-one.
| Compound Name | 1-phenyl-6,8,9,9a-tetrahydro-3H-[1,3]thiazino[3,4-d][1,2,4]triazin-4-one |
|---|---|
| PubChem CID | 66965420 |
| Molecular Formula | C12H13N3OS |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 1-phenyl-6,8,9,9a-tetrahydro-3H-[1,3]thiazino[3,4-d][1,2,4]triazin-4-one |
| SMILES | O=C1NN=C(c2ccccc2)C2CCSCN12 |
| InChI | InChI=1S/C12H13N3OS/c16-12-14-13-11(9-4-2-1-3-5-9)10-6-7-17-8-15(10)12/h1-5,10H,6-8H2,(H,14,16) |
| InChIKey | WVNFMTVQWBHEBT-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |