C15H17N5O — CID 66965441
N'-[3-(5-oxo-2,3,4,6-tetrahydro-1H-pyrido[2,3-d]pyridazin-8-yl)phenyl]ethanimidamide (PubChem CID 66965441) has the molecular formula C15H17N5O and a molecular weight of 283.34 g/mol. Its IUPAC name is N'-[3-(5-oxo-2,3,4,6-tetrahydro-1H-pyrido[2,3-d]pyridazin-8-yl)phenyl]ethanimidamide.
| Compound Name | N'-[3-(5-oxo-2,3,4,6-tetrahydro-1H-pyrido[2,3-d]pyridazin-8-yl)phenyl]ethanimidamide |
|---|---|
| PubChem CID | 66965441 |
| Molecular Formula | C15H17N5O |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | N'-[3-(5-oxo-2,3,4,6-tetrahydro-1H-pyrido[2,3-d]pyridazin-8-yl)phenyl]ethanimidamide |
| SMILES | C/C(N)=N\c1cccc(-c2n[nH]c(=O)c3c2NCCC3)c1 |
| InChI | InChI=1S/C15H17N5O/c1-9(16)18-11-5-2-4-10(8-11)13-14-12(6-3-7-17-14)15(21)20-19-13/h2,4-5,8,17H,3,6-7H2,1H3,(H2,16,18)(H,20,21) |
| InChIKey | NSPIKUUKRRDEFJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|