C20H32N4O2 — CID 66965485
N-[4-(cyclohexylamino)butyl]-2-(4-oxo-5,6,7,8-tetrahydro-3H-phthalazin-1-yl)acetamide (PubChem CID 66965485) has the molecular formula C20H32N4O2 and a molecular weight of 360.50 g/mol. Its IUPAC name is N-[4-(cyclohexylamino)butyl]-2-(4-oxo-5,6,7,8-tetrahydro-3H-phthalazin-1-yl)acetamide.
| Compound Name | N-[4-(cyclohexylamino)butyl]-2-(4-oxo-5,6,7,8-tetrahydro-3H-phthalazin-1-yl)acetamide |
|---|---|
| PubChem CID | 66965485 |
| Molecular Formula | C20H32N4O2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.25 |
| IUPAC Name | N-[4-(cyclohexylamino)butyl]-2-(4-oxo-5,6,7,8-tetrahydro-3H-phthalazin-1-yl)acetamide |
| SMILES | O=C(Cc1n[nH]c(=O)c2c1CCCC2)NCCCCNC1CCCCC1 |
| InChI | InChI=1S/C20H32N4O2/c25-19(22-13-7-6-12-21-15-8-2-1-3-9-15)14-18-16-10-4-5-11-17(16)20(26)24-23-18/h15,21H,1-14H2,(H,22,25)(H,24,26) |
| InChIKey | PRCBILRTRVQGSQ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|