About 6-methyl-6-(1-prop-2-enoyloxybutoxy)cyclohexa-2,4-diene-1-carboxylic acid
6-methyl-6-(1-prop-2-enoyloxybutoxy)cyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 66965503) has the molecular formula C15H20O5
and a molecular weight of 280.32 g/mol. Its IUPAC name is 6-methyl-6-(1-prop-2-enoyloxybutoxy)cyclohexa-2,4-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 6-methyl-6-(1-prop-2-enoyloxybutoxy)cyclohexa-2,4-diene-1-carboxylic acid |
| PubChem CID | 66965503 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 6-methyl-6-(1-prop-2-enoyloxybutoxy)cyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | C=CC(=O)OC(CCC)OC1(C)C=CC=CC1C(=O)O |
| InChI | InChI=1S/C15H20O5/c1-4-8-13(19-12(16)5-2)20-15(3)10-7-6-9-11(15)14(17)18/h5-7,9-11,13H,2,4,8H2,1,3H3,(H,17,18) |
| InChIKey | IIFKIIMKRRPPSL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-6-(1-prop-2-enoyloxybutoxy)cyclohexa-2,4-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-6-(1-prop-2-enoyloxybutoxy)cyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 6-methyl-6-(1-prop-2-enoyloxybutoxy)cyclohexa-2,4-diene-1-carboxylic acid (CID 66965503) is 6-methyl-6-(1-prop-2-enoyloxybutoxy)cyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 6-methyl-6-(1-prop-2-enoyloxybutoxy)cyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 6-methyl-6-(1-prop-2-enoyloxybutoxy)cyclohexa-2,4-diene-1-carboxylic acid is C=CC(=O)OC(CCC)OC1(C)C=CC=CC1C(=O)O.
What is the InChIKey of 6-methyl-6-(1-prop-2-enoyloxybutoxy)cyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is IIFKIIMKRRPPSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O5/c1-4-8-13(19-12(16)5-2)20-15(3)10-7-6-9-11(15)14(17)18/h5-7,9-11,13H,2,4,8H2,1,3H3,(H,17,18).
What are the key properties of 6-methyl-6-(1-prop-2-enoyloxybutoxy)cyclohexa-2,4-diene-1-carboxylic acid?
6-methyl-6-(1-prop-2-enoyloxybutoxy)cyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 280.32 g/mol, XLogP of 2.44, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-6-(1-prop-2-enoyloxybutoxy)cyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 66965503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).