C18H28N4O4 — CID 66965864
tert-butyl N-[3-[[2-(4-oxo-5,6,7,8-tetrahydro-3H-phthalazin-1-yl)acetyl]amino]propyl]carbamate (PubChem CID 66965864) has the molecular formula C18H28N4O4 and a molecular weight of 364.45 g/mol. Its IUPAC name is tert-butyl N-[3-[[2-(4-oxo-5,6,7,8-tetrahydro-3H-phthalazin-1-yl)acetyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[2-(4-oxo-5,6,7,8-tetrahydro-3H-phthalazin-1-yl)acetyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 66965864 |
| Molecular Formula | C18H28N4O4 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | tert-butyl N-[3-[[2-(4-oxo-5,6,7,8-tetrahydro-3H-phthalazin-1-yl)acetyl]amino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCNC(=O)Cc1n[nH]c(=O)c2c1CCCC2 |
| InChI | InChI=1S/C18H28N4O4/c1-18(2,3)26-17(25)20-10-6-9-19-15(23)11-14-12-7-4-5-8-13(12)16(24)22-21-14/h4-11H2,1-3H3,(H,19,23)(H,20,25)(H,22,24) |
| InChIKey | OZXNTLSQGUUBHI-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|