C10H11N3OS2 — CID 66965989
4-thiophen-2-yl-6,7,9,9a-tetrahydro-2H-[1,4]thiazino[4,3-d][1,2,4]triazin-1-one (PubChem CID 66965989) has the molecular formula C10H11N3OS2 and a molecular weight of 253.35 g/mol. Its IUPAC name is 4-thiophen-2-yl-6,7,9,9a-tetrahydro-2H-[1,4]thiazino[4,3-d][1,2,4]triazin-1-one.
| Compound Name | 4-thiophen-2-yl-6,7,9,9a-tetrahydro-2H-[1,4]thiazino[4,3-d][1,2,4]triazin-1-one |
|---|---|
| PubChem CID | 66965989 |
| Molecular Formula | C10H11N3OS2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | 4-thiophen-2-yl-6,7,9,9a-tetrahydro-2H-[1,4]thiazino[4,3-d][1,2,4]triazin-1-one |
| SMILES | O=C1NN=C(c2cccs2)N2CCSCC12 |
| InChI | InChI=1S/C10H11N3OS2/c14-10-7-6-15-5-3-13(7)9(11-12-10)8-2-1-4-16-8/h1-2,4,7H,3,5-6H2,(H,12,14) |
| InChIKey | VXFSAOPICFOIBI-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |