C13H14N2O — CID 66966167
(4aS,7aR)-4-phenyl-2,4a,5,6,7,7a-hexahydrocyclopenta[d]pyridazin-1-one (PubChem CID 66966167) has the molecular formula C13H14N2O and a molecular weight of 214.27 g/mol. Its IUPAC name is (4aS,7aR)-4-phenyl-2,4a,5,6,7,7a-hexahydrocyclopenta[d]pyridazin-1-one.
| Compound Name | (4aS,7aR)-4-phenyl-2,4a,5,6,7,7a-hexahydrocyclopenta[d]pyridazin-1-one |
|---|---|
| PubChem CID | 66966167 |
| Molecular Formula | C13H14N2O |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | (4aS,7aR)-4-phenyl-2,4a,5,6,7,7a-hexahydrocyclopenta[d]pyridazin-1-one |
| SMILES | O=C1NN=C(c2ccccc2)[C@H]2CCC[C@@H]12 |
| InChI | InChI=1S/C13H14N2O/c16-13-11-8-4-7-10(11)12(14-15-13)9-5-2-1-3-6-9/h1-3,5-6,10-11H,4,7-8H2,(H,15,16)/t10-,11+/m0/s1 |
| InChIKey | DZUXOSYNWJNJIX-WDEREUQCSA-N |
| XLogP | 1.94 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |