C11H12O4 — CID 66966450
methyl (2E)-2-(3-oxo-4,5,6,7-tetrahydro-2-benzofuran-1-ylidene)acetate (PubChem CID 66966450) has the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. Its IUPAC name is methyl (2E)-2-(3-oxo-4,5,6,7-tetrahydro-2-benzofuran-1-ylidene)acetate.
| Compound Name | methyl (2E)-2-(3-oxo-4,5,6,7-tetrahydro-2-benzofuran-1-ylidene)acetate |
|---|---|
| PubChem CID | 66966450 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | methyl (2E)-2-(3-oxo-4,5,6,7-tetrahydro-2-benzofuran-1-ylidene)acetate |
| SMILES | COC(=O)/C=C1/OC(=O)C2=C1CCCC2 |
| InChI | InChI=1S/C11H12O4/c1-14-10(12)6-9-7-4-2-3-5-8(7)11(13)15-9/h6H,2-5H2,1H3/b9-6+ |
| InChIKey | ROJYZVWRKFXCHZ-RMKNXTFCSA-N |
| XLogP | 1.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|