C25H28N4O4S — CID 66966476
3-[3-(2,2-dimethoxyethyl)-2-oxo-1,4-dihydropyrido[2,3-d]pyrimidin-6-yl]-N-methyl-N-[(3-methyl-1-benzothiophen-2-yl)methyl]prop-2-enamide (PubChem CID 66966476) has the molecular formula C25H28N4O4S and a molecular weight of 480.59 g/mol. Its IUPAC name is 3-[3-(2,2-dimethoxyethyl)-2-oxo-1,4-dihydropyrido[2,3-d]pyrimidin-6-yl]-N-methyl-N-[(3-methyl-1-benzothiophen-2-yl)methyl]prop-2-enamide.
| Compound Name | 3-[3-(2,2-dimethoxyethyl)-2-oxo-1,4-dihydropyrido[2,3-d]pyrimidin-6-yl]-N-methyl-N-[(3-methyl-1-benzothiophen-2-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 66966476 |
| Molecular Formula | C25H28N4O4S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | 3-[3-(2,2-dimethoxyethyl)-2-oxo-1,4-dihydropyrido[2,3-d]pyrimidin-6-yl]-N-methyl-N-[(3-methyl-1-benzothiophen-2-yl)methyl]prop-2-enamide |
| SMILES | COC(CN1Cc2cc(C=CC(=O)N(C)Cc3sc4ccccc4c3C)cnc2NC1=O)OC |
| InChI | InChI=1S/C25H28N4O4S/c1-16-19-7-5-6-8-20(19)34-21(16)14-28(2)22(30)10-9-17-11-18-13-29(15-23(32-3)33-4)25(31)27-24(18)26-12-17/h5-12,23H,13-15H2,1-4H3,(H,26,27,31) |
| InChIKey | WMQZADDSXGKUAE-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|