C11H10N4O3S — CID 66966655
(8aR)-4-(3-nitrophenyl)-2,6,8,8a-tetrahydro-[1,3]thiazolo[3,4-d][1,2,4]triazin-1-one (PubChem CID 66966655) has the molecular formula C11H10N4O3S and a molecular weight of 278.29 g/mol. Its IUPAC name is (8aR)-4-(3-nitrophenyl)-2,6,8,8a-tetrahydro-[1,3]thiazolo[3,4-d][1,2,4]triazin-1-one.
| Compound Name | (8aR)-4-(3-nitrophenyl)-2,6,8,8a-tetrahydro-[1,3]thiazolo[3,4-d][1,2,4]triazin-1-one |
|---|---|
| PubChem CID | 66966655 |
| Molecular Formula | C11H10N4O3S |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | (8aR)-4-(3-nitrophenyl)-2,6,8,8a-tetrahydro-[1,3]thiazolo[3,4-d][1,2,4]triazin-1-one |
| SMILES | O=C1NN=C(c2cccc([N+](=O)[O-])c2)N2CSC[C@@H]12 |
| InChI | InChI=1S/C11H10N4O3S/c16-11-9-5-19-6-14(9)10(12-13-11)7-2-1-3-8(4-7)15(17)18/h1-4,9H,5-6H2,(H,13,16)/t9-/m0/s1 |
| InChIKey | DTEZDEOSXIIQLV-VIFPVBQESA-N |
| XLogP | 0.76 |
| TPSA | 87.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|